C26H23NO9 — CID 163093533
5-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-2-hydroxy-3-methylbenzoic acid (PubChem CID 163093533) has the molecular formula C26H23NO9 and a molecular weight of 493.47 g/mol. Its IUPAC name is 5-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 163093533 |
| Molecular Formula | C26H23NO9 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 5-[1-(6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene)ethylamino]-2-hydroxy-3-methylbenzoic acid |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)Nc3cc(C)c(O)c(C(=O)O)c3)C(=O)C12C |
| InChI | InChI=1S/C26H23NO9/c1-9-6-13(7-14(20(9)30)25(34)35)27-11(3)17-15(29)8-16-26(5,24(17)33)19-22(32)10(2)21(31)18(12(4)28)23(19)36-16/h6-8,27,30-32H,1-5H3,(H,34,35) |
| InChIKey | WGMAGQZTZPMZTI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|