C29H27ClN2O6 — CID 110207263
(2E,9bR)-6-acetyl-2-[1-[3-(6-chloroindol-1-yl)propylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 110207263) has the molecular formula C29H27ClN2O6 and a molecular weight of 535.00 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-2-[1-[3-(6-chloroindol-1-yl)propylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-2-[1-[3-(6-chloroindol-1-yl)propylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 110207263 |
| Molecular Formula | C29H27ClN2O6 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (2E,9bR)-6-acetyl-2-[1-[3-(6-chloroindol-1-yl)propylamino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCCCn3ccc4ccc(Cl)cc43)C(=O)[C@@]12C |
| InChI | InChI=1S/C29H27ClN2O6/c1-14-25(35)23(16(3)33)27-24(26(14)36)29(4)21(38-27)13-20(34)22(28(29)37)15(2)31-9-5-10-32-11-8-17-6-7-18(30)12-19(17)32/h6-8,11-13,31,35-36H,5,9-10H2,1-4H3/b22-15+/t29-/m0/s1 |
| InChIKey | ORFKSDKPNGNEGI-NKVKBKOUSA-N |
| XLogP | 4.86 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|