C29H29N3O6 — CID 171135412
(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[3-(1-methylbenzimidazol-2-yl)propylamino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 171135412) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[3-(1-methylbenzimidazol-2-yl)propylamino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[3-(1-methylbenzimidazol-2-yl)propylamino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135412 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[3-(1-methylbenzimidazol-2-yl)propylamino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCCc3nc4ccccc4n3C)C(=O)[C@@]12C |
| InChI | InChI=1S/C29H29N3O6/c1-14-25(35)23(16(3)33)27-24(26(14)36)29(4)20(38-27)13-19(34)22(28(29)37)15(2)30-12-8-11-21-31-17-9-6-7-10-18(17)32(21)5/h6-7,9-10,13,30,35-36H,8,11-12H2,1-5H3/t29-/m0/s1 |
| InChIKey | ZHCOFPZPJYNAMM-LJAQVGFWSA-N |
| XLogP | 3.68 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|