C33H37N3O6 — CID 171135311
(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[5-(1-propan-2-ylbenzimidazol-2-yl)pentylamino]ethylidene]dibenzofuran-1,3-dione (PubChem CID 171135311) has the molecular formula C33H37N3O6 and a molecular weight of 571.67 g/mol. Its IUPAC name is (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[5-(1-propan-2-ylbenzimidazol-2-yl)pentylamino]ethylidene]dibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[5-(1-propan-2-ylbenzimidazol-2-yl)pentylamino]ethylidene]dibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135311 |
| Molecular Formula | C33H37N3O6 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-2-[1-[5-(1-propan-2-ylbenzimidazol-2-yl)pentylamino]ethylidene]dibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCCCCc3nc4ccccc4n3C(C)C)C(=O)[C@@]12C |
| InChI | InChI=1S/C33H37N3O6/c1-17(2)36-22-13-10-9-12-21(22)35-25(36)14-8-7-11-15-34-19(4)26-23(38)16-24-33(6,32(26)41)28-30(40)18(3)29(39)27(20(5)37)31(28)42-24/h9-10,12-13,16-17,34,39-40H,7-8,11,14-15H2,1-6H3/t33-/m0/s1 |
| InChIKey | YTBWBTUBKPBLKO-XIFFEERXSA-N |
| XLogP | 5.50 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|