C32H31NO7 — CID 171135381
(9bR)-6-acetyl-2-[1-[[3-(furan-2-yl)-4-phenylbutyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 171135381) has the molecular formula C32H31NO7 and a molecular weight of 541.60 g/mol. Its IUPAC name is (9bR)-6-acetyl-2-[1-[[3-(furan-2-yl)-4-phenylbutyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (9bR)-6-acetyl-2-[1-[[3-(furan-2-yl)-4-phenylbutyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 171135381 |
| Molecular Formula | C32H31NO7 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (9bR)-6-acetyl-2-[1-[[3-(furan-2-yl)-4-phenylbutyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCC(Cc3ccccc3)c3ccco3)C(=O)[C@@]12C |
| InChI | InChI=1S/C32H31NO7/c1-17-28(36)26(19(3)34)30-27(29(17)37)32(4)24(40-30)16-22(35)25(31(32)38)18(2)33-13-12-21(23-11-8-14-39-23)15-20-9-6-5-7-10-20/h5-11,14,16,21,33,36-37H,12-13,15H2,1-4H3/t21?,32-/m0/s1 |
| InChIKey | GOGAFENJKBEXJM-SOFIOUBHSA-N |
| XLogP | 5.17 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|