About [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate
[(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate (PubChem CID 162990224) has the molecular formula C8H16O2S3
and a molecular weight of 240.41 g/mol. Its IUPAC name is [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate.
Molecular Properties
| Compound Name | [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate |
| PubChem CID | 162990224 |
| Molecular Formula | C8H16O2S3 |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate |
| SMILES | CC[C@@H](C)SSC/C=C/O[S@](C)=O |
| InChI | InChI=1S/C8H16O2S3/c1-4-8(2)12-11-7-5-6-10-13(3)9/h5-6,8H,4,7H2,1-3H3/b6-5+/t8-,13-/m1/s1 |
| InChIKey | OQCBJFYTNWYVQJ-MRIIINAHSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate?
The IUPAC name of [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate (CID 162990224) is [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate.
What is the SMILES notation for [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate?
The canonical SMILES for [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate is CC[C@@H](C)SSC/C=C/O[S@](C)=O.
What is the InChIKey of [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate?
The InChIKey is OQCBJFYTNWYVQJ-MRIIINAHSA-N. The full InChI is InChI=1S/C8H16O2S3/c1-4-8(2)12-11-7-5-6-10-13(3)9/h5-6,8H,4,7H2,1-3H3/b6-5+/t8-,13-/m1/s1.
What are the key properties of [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate?
[(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate has a molecular weight of 240.41 g/mol, XLogP of 2.99, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[[(2R)-butan-2-yl]disulfanyl]prop-1-enyl] (R)-methanesulfinate is sourced from PubChem (CID 162990224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).