C10H20N2O2S4 — CID 21150748
N,N'-bis(butan-2-yldisulfanyl)oxamide (PubChem CID 21150748) has the molecular formula C10H20N2O2S4 and a molecular weight of 328.55 g/mol. Its IUPAC name is N,N'-bis(butan-2-yldisulfanyl)oxamide.
| Compound Name | N,N'-bis(butan-2-yldisulfanyl)oxamide |
|---|---|
| PubChem CID | 21150748 |
| Molecular Formula | C10H20N2O2S4 |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N,N'-bis(butan-2-yldisulfanyl)oxamide |
| SMILES | CCC(C)SSNC(=O)C(=O)NSSC(C)CC |
| InChI | InChI=1S/C10H20N2O2S4/c1-5-7(3)15-17-11-9(13)10(14)12-18-16-8(4)6-2/h7-8H,5-6H2,1-4H3,(H,11,13)(H,12,14) |
| InChIKey | SNXRCJJWPALOOA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|