About butan-2-ylsulfanyl propanoate
butan-2-ylsulfanyl propanoate (PubChem CID 57189829) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is butan-2-ylsulfanyl propanoate.
Molecular Properties
| Compound Name | butan-2-ylsulfanyl propanoate |
| PubChem CID | 57189829 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | butan-2-ylsulfanyl propanoate |
| SMILES | CCC(=O)OSC(C)CC |
| InChI | InChI=1S/C7H14O2S/c1-4-6(3)10-9-7(8)5-2/h6H,4-5H2,1-3H3 |
| InChIKey | MRGQZZPRDGMBCB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylsulfanyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylsulfanyl propanoate?
The IUPAC name of butan-2-ylsulfanyl propanoate (CID 57189829) is butan-2-ylsulfanyl propanoate.
What is the SMILES notation for butan-2-ylsulfanyl propanoate?
The canonical SMILES for butan-2-ylsulfanyl propanoate is CCC(=O)OSC(C)CC.
What is the InChIKey of butan-2-ylsulfanyl propanoate?
The InChIKey is MRGQZZPRDGMBCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S/c1-4-6(3)10-9-7(8)5-2/h6H,4-5H2,1-3H3.
What are the key properties of butan-2-ylsulfanyl propanoate?
butan-2-ylsulfanyl propanoate has a molecular weight of 162.25 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylsulfanyl propanoate is sourced from PubChem (CID 57189829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).