About butan-2-yl thiohypochlorite;carbamic acid
butan-2-yl thiohypochlorite;carbamic acid (PubChem CID 88674015) has the molecular formula C5H12ClNO2S
and a molecular weight of 185.68 g/mol. Its IUPAC name is butan-2-yl thiohypochlorite;carbamic acid.
Molecular Properties
| Compound Name | butan-2-yl thiohypochlorite;carbamic acid |
| PubChem CID | 88674015 |
| Molecular Formula | C5H12ClNO2S |
| Molecular Weight | 185.68 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | butan-2-yl thiohypochlorite;carbamic acid |
| SMILES | CCC(C)SCl.NC(=O)O |
| InChI | InChI=1S/C4H9ClS.CH3NO2/c1-3-4(2)6-5;2-1(3)4/h4H,3H2,1-2H3;2H2,(H,3,4) |
| InChIKey | LPBZVNJOCFIICB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.68 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-yl thiohypochlorite;carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl thiohypochlorite;carbamic acid?
The IUPAC name of butan-2-yl thiohypochlorite;carbamic acid (CID 88674015) is butan-2-yl thiohypochlorite;carbamic acid.
What is the SMILES notation for butan-2-yl thiohypochlorite;carbamic acid?
The canonical SMILES for butan-2-yl thiohypochlorite;carbamic acid is CCC(C)SCl.NC(=O)O.
What is the InChIKey of butan-2-yl thiohypochlorite;carbamic acid?
The InChIKey is LPBZVNJOCFIICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClS.CH3NO2/c1-3-4(2)6-5;2-1(3)4/h4H,3H2,1-2H3;2H2,(H,3,4).
What are the key properties of butan-2-yl thiohypochlorite;carbamic acid?
butan-2-yl thiohypochlorite;carbamic acid has a molecular weight of 185.68 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl thiohypochlorite;carbamic acid is sourced from PubChem (CID 88674015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).