butan-2-yl thiohypochlorite;carbamic acid

C5H12ClNO2S — CID 88674015

IUPACbutan-2-yl thiohypochlorite;carbamic acid
SMILESCCC(C)SCl.NC(=O)O
InChIInChI=1S/C4H9ClS.CH3NO2/c1-3-4(2)6-5;2-1(3)4/h4H,3H2,1-2H3;2H2,(H,3,4)
InChIKeyLPBZVNJOCFIICB-UHFFFAOYSA-N
MW185.68 g/mol
LogP2.30
Rot. Bonds2

About butan-2-yl thiohypochlorite;carbamic acid

butan-2-yl thiohypochlorite;carbamic acid (PubChem CID 88674015) has the molecular formula C5H12ClNO2S and a molecular weight of 185.68 g/mol. Its IUPAC name is butan-2-yl thiohypochlorite;carbamic acid.

Molecular Properties

Compound Namebutan-2-yl thiohypochlorite;carbamic acid
PubChem CID88674015
Molecular FormulaC5H12ClNO2S
Molecular Weight185.68 g/mol
Exact Mass185.03
IUPAC Namebutan-2-yl thiohypochlorite;carbamic acid
SMILESCCC(C)SCl.NC(=O)O
InChIInChI=1S/C4H9ClS.CH3NO2/c1-3-4(2)6-5;2-1(3)4/h4H,3H2,1-2H3;2H2,(H,3,4)
InChIKeyLPBZVNJOCFIICB-UHFFFAOYSA-N
XLogP2.30
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.68
LogP ≤ 52.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze butan-2-yl thiohypochlorite;carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-yl thiohypochlorite;carbamic acid?
The IUPAC name of butan-2-yl thiohypochlorite;carbamic acid (CID 88674015) is butan-2-yl thiohypochlorite;carbamic acid.
What is the SMILES notation for butan-2-yl thiohypochlorite;carbamic acid?
The canonical SMILES for butan-2-yl thiohypochlorite;carbamic acid is CCC(C)SCl.NC(=O)O.
What is the InChIKey of butan-2-yl thiohypochlorite;carbamic acid?
The InChIKey is LPBZVNJOCFIICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClS.CH3NO2/c1-3-4(2)6-5;2-1(3)4/h4H,3H2,1-2H3;2H2,(H,3,4).
What are the key properties of butan-2-yl thiohypochlorite;carbamic acid?
butan-2-yl thiohypochlorite;carbamic acid has a molecular weight of 185.68 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl thiohypochlorite;carbamic acid is sourced from PubChem (CID 88674015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).