C17H24O8 — CID 162990391
(2R,3R,4S,5S,6R)-2-[[(2R,4S)-5,7-dihydroxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162990391) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[(2R,4S)-5,7-dihydroxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[(2R,4S)-5,7-dihydroxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162990391 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2R,4S)-5,7-dihydroxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C[C@H]1C[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)Cc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C17H24O8/c1-7-2-10(4-8-3-9(19)5-11(20)13(7)8)24-17-16(23)15(22)14(21)12(6-18)25-17/h3,5,7,10,12,14-23H,2,4,6H2,1H3/t7-,10+,12+,14+,15-,16+,17+/m0/s1 |
| InChIKey | OFPJQOYOGGSWNY-UCDDJPGMSA-N |
| XLogP | -0.67 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |