C21H30O5 — CID 162990839
8-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethylocta-3,6-dien-2-ol (PubChem CID 162990839) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 8-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethylocta-3,6-dien-2-ol.
| Compound Name | 8-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethylocta-3,6-dien-2-ol |
|---|---|
| PubChem CID | 162990839 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 8-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethylocta-3,6-dien-2-ol |
| SMILES | COc1cc(C=CCO)cc(OC)c1OCC=C(C)CC=CC(C)(C)O |
| InChI | InChI=1S/C21H30O5/c1-16(8-6-11-21(2,3)23)10-13-26-20-18(24-4)14-17(9-7-12-22)15-19(20)25-5/h6-7,9-11,14-15,22-23H,8,12-13H2,1-5H3 |
| InChIKey | YJTIOQZTJIAHSO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|