C23H34O5 — CID 163027506
10-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethyldeca-3,6-dien-2-ol (PubChem CID 163027506) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 10-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethyldeca-3,6-dien-2-ol.
| Compound Name | 10-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethyldeca-3,6-dien-2-ol |
|---|---|
| PubChem CID | 163027506 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 10-[4-(3-hydroxyprop-1-enyl)-2,6-dimethoxyphenoxy]-2,6-dimethyldeca-3,6-dien-2-ol |
| SMILES | COc1cc(C=CCO)cc(OC)c1OCCCC=C(C)CC=CC(C)(C)O |
| InChI | InChI=1S/C23H34O5/c1-18(11-8-13-23(2,3)25)10-6-7-15-28-22-20(26-4)16-19(12-9-14-24)17-21(22)27-5/h8-10,12-13,16-17,24-25H,6-7,11,14-15H2,1-5H3 |
| InChIKey | YVSCKGOCDLCJCI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|