C15H19Br3O3 — CID 162992661
(2R,3'S,3aR,5R,5'S,6aR)-3'-bromo-5'-[(1S)-1-bromopropyl]-2-(1-bromoprop-2-ynyl)spiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,2'-oxolane] (PubChem CID 162992661) has the molecular formula C15H19Br3O3 and a molecular weight of 487.03 g/mol. Its IUPAC name is (2R,3'S,3aR,5R,5'S,6aR)-3'-bromo-5'-[(1S)-1-bromopropyl]-2-(1-bromoprop-2-ynyl)spiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,2'-oxolane].
| Compound Name | (2R,3'S,3aR,5R,5'S,6aR)-3'-bromo-5'-[(1S)-1-bromopropyl]-2-(1-bromoprop-2-ynyl)spiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,2'-oxolane] |
|---|---|
| PubChem CID | 162992661 |
| Molecular Formula | C15H19Br3O3 |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 483.89 |
| IUPAC Name | (2R,3'S,3aR,5R,5'S,6aR)-3'-bromo-5'-[(1S)-1-bromopropyl]-2-(1-bromoprop-2-ynyl)spiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,2'-oxolane] |
| SMILES | C#CC(Br)[C@H]1C[C@H]2O[C@]3(C[C@H]2O1)O[C@H]([C@@H](Br)CC)C[C@@H]3Br |
| InChI | InChI=1S/C15H19Br3O3/c1-3-8(16)10-5-12-13(19-10)7-15(21-12)14(18)6-11(20-15)9(17)4-2/h1,8-14H,4-7H2,2H3/t8?,9-,10+,11-,12+,13+,14-,15-/m0/s1 |
| InChIKey | ZDAHHEMGBUAIGE-IVEBCBJRSA-N |
| XLogP | 3.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|