C16H31NO — CID 162993696
7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)heptan-1-ol (PubChem CID 162993696) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)heptan-1-ol.
| Compound Name | 7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)heptan-1-ol |
|---|---|
| PubChem CID | 162993696 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)heptan-1-ol |
| SMILES | CC1CCC(CCCCCCCO)N2CCCC12 |
| InChI | InChI=1S/C16H31NO/c1-14-10-11-15(17-12-7-9-16(14)17)8-5-3-2-4-6-13-18/h14-16,18H,2-13H2,1H3 |
| InChIKey | APMYDBPENKLBFT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|