C36H64O9 — CID 162997785
(2S,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(6E,10R,11S,14R,15R,18E)-10,14,15-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,6,18,22-tetraen-11-yl]oxyoxane-3,4,5-triol (PubChem CID 162997785) has the molecular formula C36H64O9 and a molecular weight of 640.90 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(6E,10R,11S,14R,15R,18E)-10,14,15-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,6,18,22-tetraen-11-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(6E,10R,11S,14R,15R,18E)-10,14,15-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,6,18,22-tetraen-11-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 162997785 |
| Molecular Formula | C36H64O9 |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.46 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(6E,10R,11S,14R,15R,18E)-10,14,15-trihydroxy-2,6,10,15,19,23-hexamethyltetracosa-2,6,18,22-tetraen-11-yl]oxyoxane-3,4,5-triol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@](C)(O)[C@H](O)CC[C@H](O[C@@H]1O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@](C)(O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C36H64O9/c1-24(2)13-9-15-26(5)17-11-21-35(7,42)29(38)19-20-30(45-34-33(41)32(40)31(39)28(23-37)44-34)36(8,43)22-12-18-27(6)16-10-14-25(3)4/h13-14,17-18,28-34,37-43H,9-12,15-16,19-23H2,1-8H3/b26-17+,27-18+/t28-,29+,30-,31+,32-,33+,34-,35+,36+/m0/s1 |
| InChIKey | BPAZLCDDGKMQTO-VZCFVBPOSA-N |
| XLogP | 4.76 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|