C21H30O5 — CID 162999010
methyl 2-[(4R,4aR,4bR,8aR,10aR)-4,10a-dihydroxy-4b,8,8-trimethyl-3-oxo-4,4a,5,6,7,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate (PubChem CID 162999010) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 2-[(4R,4aR,4bR,8aR,10aR)-4,10a-dihydroxy-4b,8,8-trimethyl-3-oxo-4,4a,5,6,7,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(4R,4aR,4bR,8aR,10aR)-4,10a-dihydroxy-4b,8,8-trimethyl-3-oxo-4,4a,5,6,7,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162999010 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | methyl 2-[(4R,4aR,4bR,8aR,10aR)-4,10a-dihydroxy-4b,8,8-trimethyl-3-oxo-4,4a,5,6,7,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1=C[C@]2(O)CC[C@@H]3C(C)(C)CCC[C@@]3(C)[C@@H]2[C@@H](O)C1=O |
| InChI | InChI=1S/C21H30O5/c1-12(18(24)26-5)13-11-21(25)10-7-14-19(2,3)8-6-9-20(14,4)17(21)16(23)15(13)22/h11,14,16-17,23,25H,1,6-10H2,2-5H3/t14-,16+,17+,20-,21-/m1/s1 |
| InChIKey | LOBYRCPBPVLZQV-WGMOTNOQSA-N |
| XLogP | 2.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|