C18H22O10 — CID 162999751
[(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(3R)-5-oxooxolan-3-yl]oxyoxan-3-yl] 2-(4-hydroxyphenyl)acetate (PubChem CID 162999751) has the molecular formula C18H22O10 and a molecular weight of 398.36 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(3R)-5-oxooxolan-3-yl]oxyoxan-3-yl] 2-(4-hydroxyphenyl)acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(3R)-5-oxooxolan-3-yl]oxyoxan-3-yl] 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 162999751 |
| Molecular Formula | C18H22O10 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(3R)-5-oxooxolan-3-yl]oxyoxan-3-yl] 2-(4-hydroxyphenyl)acetate |
| SMILES | O=C1C[C@@H](O[C@@H]2O[C@H](CO)[C@H](OC(=O)Cc3ccc(O)cc3)[C@H](O)[C@@H]2O)CO1 |
| InChI | InChI=1S/C18H22O10/c19-7-12-17(28-14(22)5-9-1-3-10(20)4-2-9)15(23)16(24)18(27-12)26-11-6-13(21)25-8-11/h1-4,11-12,15-20,23-24H,5-8H2/t11-,12-,15-,16+,17+,18-/m1/s1 |
| InChIKey | ZNBBYALXAQXHJE-ZFPNSWABSA-N |
| XLogP | -1.38 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |