C30H29O12- — CID 102242107
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris[[2-(4-hydroxyphenyl)acetyl]oxy]oxan-2-olate (PubChem CID 102242107) has the molecular formula C30H29O12- and a molecular weight of 581.55 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris[[2-(4-hydroxyphenyl)acetyl]oxy]oxan-2-olate.
| Compound Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris[[2-(4-hydroxyphenyl)acetyl]oxy]oxan-2-olate |
|---|---|
| PubChem CID | 102242107 |
| Molecular Formula | C30H29O12- |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-3,4,5-tris[[2-(4-hydroxyphenyl)acetyl]oxy]oxan-2-olate |
| SMILES | O=C(Cc1ccc(O)cc1)O[C@@H]1[C@@H](OC(=O)Cc2ccc(O)cc2)[C@H]([O-])O[C@H](CO)[C@H]1OC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C30H29O12/c31-16-23-27(40-24(35)13-17-1-7-20(32)8-2-17)28(41-25(36)14-18-3-9-21(33)10-4-18)29(30(38)39-23)42-26(37)15-19-5-11-22(34)12-6-19/h1-12,23,27-34H,13-16H2/q-1/t23-,27-,28+,29-,30-/m1/s1 |
| InChIKey | WVRVIOVFNCBWEW-VLYBHXKQSA-N |
| XLogP | 0.64 |
| TPSA | 192.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|