C14H18O8 — CID 162979940
[(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(4-hydroxyphenyl)acetate (PubChem CID 162979940) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is [(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(4-hydroxyphenyl)acetate.
| Compound Name | [(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 162979940 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] 2-(4-hydroxyphenyl)acetate |
| SMILES | O=C(Cc1ccc(O)cc1)OC1[C@@H](O)[C@H](O)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18O8/c15-7-3-1-6(2-4-7)5-8(16)22-14-12(20)10(18)9(17)11(19)13(14)21/h1-4,9-15,17-21H,5H2/t9?,10-,11-,12-,13+,14?/m1/s1 |
| InChIKey | DYXTYVPJBXFSMA-SSWXJSDOSA-N |
| XLogP | -2.34 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |