C32H32O13 — CID 52938188
2-[(1R,3S,4S,5S)-1,3-dihydroxy-4,5-bis[[2-(4-hydroxyphenyl)acetyl]oxy]cyclohexanecarbonyl]oxy-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 52938188) has the molecular formula C32H32O13 and a molecular weight of 624.60 g/mol. Its IUPAC name is 2-[(1R,3S,4S,5S)-1,3-dihydroxy-4,5-bis[[2-(4-hydroxyphenyl)acetyl]oxy]cyclohexanecarbonyl]oxy-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[(1R,3S,4S,5S)-1,3-dihydroxy-4,5-bis[[2-(4-hydroxyphenyl)acetyl]oxy]cyclohexanecarbonyl]oxy-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 52938188 |
| Molecular Formula | C32H32O13 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.18 |
| IUPAC Name | 2-[(1R,3S,4S,5S)-1,3-dihydroxy-4,5-bis[[2-(4-hydroxyphenyl)acetyl]oxy]cyclohexanecarbonyl]oxy-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(Cc1ccc(O)cc1)O[C@@H]1[C@@H](OC(=O)Cc2ccc(O)cc2)C[C@@](O)(C(=O)OC(Cc2ccc(O)cc2)C(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C32H32O13/c33-21-7-1-18(2-8-21)13-25(30(39)40)44-31(41)32(42)16-24(36)29(45-28(38)15-20-5-11-23(35)12-6-20)26(17-32)43-27(37)14-19-3-9-22(34)10-4-19/h1-12,24-26,29,33-36,42H,13-17H2,(H,39,40)/t24-,25?,26-,29-,32+/m0/s1 |
| InChIKey | LESXOEULFPJUKK-UJKVOPOSSA-N |
| XLogP | 1.54 |
| TPSA | 217.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|