C27H38O8 — CID 163006102
(20-acetyloxy-6-hydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-7-yl) acetate (PubChem CID 163006102) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is (20-acetyloxy-6-hydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-7-yl) acetate.
| Compound Name | (20-acetyloxy-6-hydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-7-yl) acetate |
|---|---|
| PubChem CID | 163006102 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | (20-acetyloxy-6-hydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-7-yl) acetate |
| SMILES | C=C1C2CC3OC(C)(C)OC4CCC(C)(C)C5C(OC(C)=O)C6(O)OCC45C3C6(C2)C1OC(C)=O |
| InChI | InChI=1S/C27H38O8/c1-13-16-10-17-19-25-12-31-27(30,26(19,11-16)21(13)32-14(2)28)22(33-15(3)29)20(25)23(4,5)9-8-18(25)35-24(6,7)34-17/h16-22,30H,1,8-12H2,2-7H3 |
| InChIKey | ICDHTKBXLLBPQJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|