C38H64O4 — CID 163011818
1,4a-dimethyl-6-methylidene-5-(3-methyl-5-octadec-9-enoyloxypent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid (PubChem CID 163011818) has the molecular formula C38H64O4 and a molecular weight of 584.93 g/mol. Its IUPAC name is 1,4a-dimethyl-6-methylidene-5-(3-methyl-5-octadec-9-enoyloxypent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid.
| Compound Name | 1,4a-dimethyl-6-methylidene-5-(3-methyl-5-octadec-9-enoyloxypent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 163011818 |
| Molecular Formula | C38H64O4 |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 584.48 |
| IUPAC Name | 1,4a-dimethyl-6-methylidene-5-(3-methyl-5-octadec-9-enoyloxypent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
| SMILES | C=C1CCC2C(C)(C(=O)O)CCCC2(C)C1CCC(C)=CCOC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C38H64O4/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-35(39)42-30-27-31(2)23-25-33-32(3)24-26-34-37(33,4)28-21-29-38(34,5)36(40)41/h13-14,27,33-34H,3,6-12,15-26,28-30H2,1-2,4-5H3,(H,40,41) |
| InChIKey | QPJHXFZKKVBKCC-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|