C38H64O2 — CID 162890606
[3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nona-2,6-dienyl] octadeca-9,12,15-trienoate (PubChem CID 162890606) has the molecular formula C38H64O2 and a molecular weight of 552.93 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nona-2,6-dienyl] octadeca-9,12,15-trienoate.
| Compound Name | [3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nona-2,6-dienyl] octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 162890606 |
| Molecular Formula | C38H64O2 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.49 |
| IUPAC Name | [3,7-dimethyl-9-(2,2,6-trimethylcyclohexyl)nona-2,6-dienyl] octadeca-9,12,15-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OCC=C(C)CCC=C(C)CCC1C(C)CCCC1(C)C |
| InChI | InChI=1S/C38H64O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27-37(39)40-32-30-34(3)25-22-24-33(2)28-29-36-35(4)26-23-31-38(36,5)6/h8-9,11-12,14-15,24,30,35-36H,7,10,13,16-23,25-29,31-32H2,1-6H3 |
| InChIKey | VJUPRJREQSSSMD-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|