C18H28O5 — CID 163013449
[(1aR,4S,4aS,5R,8aS)-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] 2-[[(1R)-1-hydroxyethoxy]methyl]prop-2-enoate (PubChem CID 163013449) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(1aR,4S,4aS,5R,8aS)-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] 2-[[(1R)-1-hydroxyethoxy]methyl]prop-2-enoate.
| Compound Name | [(1aR,4S,4aS,5R,8aS)-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] 2-[[(1R)-1-hydroxyethoxy]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 163013449 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [(1aR,4S,4aS,5R,8aS)-4,4a-dimethyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] 2-[[(1R)-1-hydroxyethoxy]methyl]prop-2-enoate |
| SMILES | C=C(CO[C@H](C)O)C(=O)O[C@@H]1CCC[C@@]23O[C@@H]2CC[C@H](C)[C@@]13C |
| InChI | InChI=1S/C18H28O5/c1-11(10-21-13(3)19)16(20)22-14-6-5-9-18-15(23-18)8-7-12(2)17(14,18)4/h12-15,19H,1,5-10H2,2-4H3/t12-,13+,14+,15+,17-,18+/m0/s1 |
| InChIKey | RCTQFLCBSIZFRT-UPUBNRDVSA-N |
| XLogP | 2.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|