C28H36O16 — CID 163014249
[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxy-3-methoxyphenoxy)oxan-2-yl]methyl 3,5-dimethoxy-4-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybenzoate (PubChem CID 163014249) has the molecular formula C28H36O16 and a molecular weight of 628.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxy-3-methoxyphenoxy)oxan-2-yl]methyl 3,5-dimethoxy-4-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybenzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxy-3-methoxyphenoxy)oxan-2-yl]methyl 3,5-dimethoxy-4-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 163014249 |
| Molecular Formula | C28H36O16 |
| Molecular Weight | 628.58 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxy-3-methoxyphenoxy)oxan-2-yl]methyl 3,5-dimethoxy-4-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybenzoate |
| SMILES | COc1cc(O[C@@H]2O[C@H](COC(=O)c3cc(OC)c(O[C@@H]4O[C@H](C)[C@H](O)[C@@H](O)[C@H]4O)c(OC)c3)[C@@H](O)[C@@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C28H36O16/c1-11-19(30)21(32)23(34)27(41-11)44-25-16(38-3)7-12(8-17(25)39-4)26(36)40-10-18-20(31)22(33)24(35)28(43-18)42-13-5-6-14(29)15(9-13)37-2/h5-9,11,18-24,27-35H,10H2,1-4H3/t11-,18-,19+,20-,21-,22-,23-,24-,27+,28-/m1/s1 |
| InChIKey | PQKVHPGJRPRJKO-NZFAKONYSA-N |
| XLogP | -1.33 |
| TPSA | 232.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.58 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |