C23H26N2O5 — CID 163014698
dimethyl (1R,9S,16R,19R,20S)-21-oxo-2,12-diazahexacyclo[10.6.2.19,16.01,9.03,8.016,20]henicosa-3,5,7-triene-2,19-dicarboxylate (PubChem CID 163014698) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is dimethyl (1R,9S,16R,19R,20S)-21-oxo-2,12-diazahexacyclo[10.6.2.19,16.01,9.03,8.016,20]henicosa-3,5,7-triene-2,19-dicarboxylate.
| Compound Name | dimethyl (1R,9S,16R,19R,20S)-21-oxo-2,12-diazahexacyclo[10.6.2.19,16.01,9.03,8.016,20]henicosa-3,5,7-triene-2,19-dicarboxylate |
|---|---|
| PubChem CID | 163014698 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | dimethyl (1R,9S,16R,19R,20S)-21-oxo-2,12-diazahexacyclo[10.6.2.19,16.01,9.03,8.016,20]henicosa-3,5,7-triene-2,19-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2N3CCC[C@@]24CC[C@@]12N(C(=O)OC)c1ccccc1[C@]2(CC3)C4=O |
| InChI | InChI=1S/C23H26N2O5/c1-29-18(26)16-17-21-8-5-12-24(17)13-11-22(19(21)27)14-6-3-4-7-15(14)25(20(28)30-2)23(16,22)10-9-21/h3-4,6-7,16-17H,5,8-13H2,1-2H3/t16-,17-,21+,22+,23+/m0/s1 |
| InChIKey | HDHSIDMPAOUGRJ-FIVLCTCKSA-N |
| XLogP | 2.27 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |