C23H24N2O6 — CID 102376667
dimethyl (1S,9S,14Z,16R)-16-hydroxy-21-oxo-2,12-diazapentacyclo[14.2.2.19,12.01,9.03,8]henicosa-3,5,7,14,17-pentaene-2,18-dicarboxylate (PubChem CID 102376667) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is dimethyl (1S,9S,14Z,16R)-16-hydroxy-21-oxo-2,12-diazapentacyclo[14.2.2.19,12.01,9.03,8]henicosa-3,5,7,14,17-pentaene-2,18-dicarboxylate.
| Compound Name | dimethyl (1S,9S,14Z,16R)-16-hydroxy-21-oxo-2,12-diazapentacyclo[14.2.2.19,12.01,9.03,8]henicosa-3,5,7,14,17-pentaene-2,18-dicarboxylate |
|---|---|
| PubChem CID | 102376667 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | dimethyl (1S,9S,14Z,16R)-16-hydroxy-21-oxo-2,12-diazapentacyclo[14.2.2.19,12.01,9.03,8]henicosa-3,5,7,14,17-pentaene-2,18-dicarboxylate |
| SMILES | COC(=O)C1=C[C@]2(O)/C=C\CN3CC[C@]4(C3=O)c3ccccc3N(C(=O)OC)[C@]14CC2 |
| InChI | InChI=1S/C23H24N2O6/c1-30-18(26)16-14-21(29)8-5-12-24-13-11-22(19(24)27)15-6-3-4-7-17(15)25(20(28)31-2)23(16,22)10-9-21/h3-8,14,29H,9-13H2,1-2H3/b8-5-/t21-,22+,23+/m0/s1 |
| InChIKey | YTPFZRPHNIOFPL-ZYZBALMFSA-N |
| XLogP | 1.68 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|