C24H26N2O7 — CID 162946749
trimethyl (1R,9S,16R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,14-tetraene-2,9,18-tricarboxylate (PubChem CID 162946749) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is trimethyl (1R,9S,16R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,14-tetraene-2,9,18-tricarboxylate.
| Compound Name | trimethyl (1R,9S,16R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,14-tetraene-2,9,18-tricarboxylate |
|---|---|
| PubChem CID | 162946749 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | trimethyl (1R,9S,16R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,14-tetraene-2,9,18-tricarboxylate |
| SMILES | COC(=O)C1C[C@]23C=CC(=O)N2CC[C@]2(C(=O)OC)c4ccccc4N(C(=O)OC)[C@]12CC3 |
| InChI | InChI=1S/C24H26N2O7/c1-31-19(28)16-14-22-9-8-18(27)25(22)13-12-23(20(29)32-2)15-6-4-5-7-17(15)26(21(30)33-3)24(16,23)11-10-22/h4-9,16H,10-14H2,1-3H3/t16?,22-,23-,24-/m1/s1 |
| InChIKey | VOHFPFMHDXIAOK-LRMJJUBBSA-N |
| XLogP | 1.94 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|