C23H25IN2O6 — CID 134967855
dimethyl (1S,9R,10S)-10-[formyl-[(Z)-2-iodobut-2-enyl]amino]-16-oxa-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,12-tetraene-8,13-dicarboxylate (PubChem CID 134967855) has the molecular formula C23H25IN2O6 and a molecular weight of 552.37 g/mol. Its IUPAC name is dimethyl (1S,9R,10S)-10-[formyl-[(Z)-2-iodobut-2-enyl]amino]-16-oxa-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,12-tetraene-8,13-dicarboxylate.
| Compound Name | dimethyl (1S,9R,10S)-10-[formyl-[(Z)-2-iodobut-2-enyl]amino]-16-oxa-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,12-tetraene-8,13-dicarboxylate |
|---|---|
| PubChem CID | 134967855 |
| Molecular Formula | C23H25IN2O6 |
| Molecular Weight | 552.37 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | dimethyl (1S,9R,10S)-10-[formyl-[(Z)-2-iodobut-2-enyl]amino]-16-oxa-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,12-tetraene-8,13-dicarboxylate |
| SMILES | C/C=C(\I)CN(C=O)[C@H]1CC=C(C(=O)OC)[C@@]23CCO[C@@]12N(C(=O)OC)c1ccccc13 |
| InChI | InChI=1S/C23H25IN2O6/c1-4-15(24)13-25(14-27)19-10-9-17(20(28)30-2)22-11-12-32-23(19,22)26(21(29)31-3)18-8-6-5-7-16(18)22/h4-9,14,19H,10-13H2,1-3H3/b15-4-/t19-,22-,23-/m0/s1 |
| InChIKey | FQKMPGUMSVOSRU-GBZDKTLCSA-N |
| XLogP | 3.30 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|