C26H37IN2O3Si — CID 11353708
methyl (1R,9R,13R)-16-[(Z)-2-iodobut-2-enyl]-13-triethylsilyloxy-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,11-tetraene-8-carboxylate (PubChem CID 11353708) has the molecular formula C26H37IN2O3Si and a molecular weight of 580.58 g/mol. Its IUPAC name is methyl (1R,9R,13R)-16-[(Z)-2-iodobut-2-enyl]-13-triethylsilyloxy-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,11-tetraene-8-carboxylate.
| Compound Name | methyl (1R,9R,13R)-16-[(Z)-2-iodobut-2-enyl]-13-triethylsilyloxy-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,11-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 11353708 |
| Molecular Formula | C26H37IN2O3Si |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | methyl (1R,9R,13R)-16-[(Z)-2-iodobut-2-enyl]-13-triethylsilyloxy-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6,11-tetraene-8-carboxylate |
| SMILES | C/C=C(\I)CN1CC[C@@]23c4ccccc4N(C(=O)OC)[C@@]12CC=C[C@H]3O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H37IN2O3Si/c1-6-20(27)19-28-18-17-25-21-13-10-11-14-22(21)29(24(30)31-5)26(25,28)16-12-15-23(25)32-33(7-2,8-3)9-4/h6,10-15,23H,7-9,16-19H2,1-5H3/b20-6-/t23-,25+,26-/m1/s1 |
| InChIKey | IJEZRLZXLKSHMG-DHKZAASZSA-N |
| XLogP | 6.60 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|