C26H38N2O3Si — CID 134839222
methyl (1R,9R,12E,17R)-12-ethylidene-17-triethylsilyloxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-triene-8-carboxylate (PubChem CID 134839222) has the molecular formula C26H38N2O3Si and a molecular weight of 454.69 g/mol. Its IUPAC name is methyl (1R,9R,12E,17R)-12-ethylidene-17-triethylsilyloxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-triene-8-carboxylate.
| Compound Name | methyl (1R,9R,12E,17R)-12-ethylidene-17-triethylsilyloxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 134839222 |
| Molecular Formula | C26H38N2O3Si |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | methyl (1R,9R,12E,17R)-12-ethylidene-17-triethylsilyloxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-triene-8-carboxylate |
| SMILES | C/C=C1/CN2CC[C@@]34c5ccccc5N(C(=O)OC)[C@@]23CC1C[C@H]4O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H38N2O3Si/c1-6-19-18-27-15-14-25-21-12-10-11-13-22(21)28(24(29)30-5)26(25,27)17-20(19)16-23(25)31-32(7-2,8-3)9-4/h6,10-13,20,23H,7-9,14-18H2,1-5H3/b19-6-/t20?,23-,25+,26-/m1/s1 |
| InChIKey | WVTLCPROMVFPQN-QRUKKMFVSA-N |
| XLogP | 5.67 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|