C20H22N2O2 — CID 135003685
(1R,11S,12E)-8-acetyl-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-trien-18-one (PubChem CID 135003685) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (1R,11S,12E)-8-acetyl-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-trien-18-one.
| Compound Name | (1R,11S,12E)-8-acetyl-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-trien-18-one |
|---|---|
| PubChem CID | 135003685 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (1R,11S,12E)-8-acetyl-12-ethylidene-8,14-diazapentacyclo[9.5.2.01,9.02,7.09,14]octadeca-2,4,6-trien-18-one |
| SMILES | C/C=C1/CN2CC[C@]34CC(=O)[C@H]1CC23N(C(C)=O)c1ccccc14 |
| InChI | InChI=1S/C20H22N2O2/c1-3-14-12-21-9-8-19-11-18(24)15(14)10-20(19,21)22(13(2)23)17-7-5-4-6-16(17)19/h3-7,15H,8-12H2,1-2H3/b14-3-/t15-,19+,20?/m0/s1 |
| InChIKey | DTIYNEWMPATCKE-NLZIROPDSA-N |
| XLogP | 2.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|