C14H13NO3 — CID 163017231
(5R)-8-methoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,9-diol (PubChem CID 163017231) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is (5R)-8-methoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,9-diol.
| Compound Name | (5R)-8-methoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,9-diol |
|---|---|
| PubChem CID | 163017231 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (5R)-8-methoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,9-diol |
| SMILES | COc1ccc2c(c1O)-c1nccc(C)c1[C@@H]2O |
| InChI | InChI=1S/C14H13NO3/c1-7-5-6-15-12-10(7)13(16)8-3-4-9(18-2)14(17)11(8)12/h3-6,13,16-17H,1-2H3/t13-/m1/s1 |
| InChIKey | ORKSTLTYNKUVPU-CYBMUJFWSA-N |
| XLogP | 2.17 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |