C15H15NO4 — CID 86150834
6,9-dimethoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,8-diol (PubChem CID 86150834) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 6,9-dimethoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,8-diol.
| Compound Name | 6,9-dimethoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,8-diol |
|---|---|
| PubChem CID | 86150834 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 6,9-dimethoxy-4-methyl-5H-indeno[3,2-b]pyridine-5,8-diol |
| SMILES | COc1cc(O)c(OC)c2c1C(O)c1c(C)ccnc1-2 |
| InChI | InChI=1S/C15H15NO4/c1-7-4-5-16-13-10(7)14(18)11-9(19-2)6-8(17)15(20-3)12(11)13/h4-6,14,17-18H,1-3H3 |
| InChIKey | GXHTXYSQTSSOKV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |