C22H32O6 — CID 163017660
6-(6-acetyloxy-4-methylhex-4-enylidene)-2-(4-methylpent-3-enyl)hept-2-enedioic acid (PubChem CID 163017660) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 6-(6-acetyloxy-4-methylhex-4-enylidene)-2-(4-methylpent-3-enyl)hept-2-enedioic acid.
| Compound Name | 6-(6-acetyloxy-4-methylhex-4-enylidene)-2-(4-methylpent-3-enyl)hept-2-enedioic acid |
|---|---|
| PubChem CID | 163017660 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 6-(6-acetyloxy-4-methylhex-4-enylidene)-2-(4-methylpent-3-enyl)hept-2-enedioic acid |
| SMILES | CC(=O)OCC=C(C)CCC=C(CCC=C(CCC=C(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H32O6/c1-16(2)8-5-10-19(21(24)25)12-7-13-20(22(26)27)11-6-9-17(3)14-15-28-18(4)23/h8,11-12,14H,5-7,9-10,13,15H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | VRZLEESCPKSTCO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|