C15H25NO — CID 163017819
N-(3-methylbutyl)deca-2,4,6-trienamide (PubChem CID 163017819) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-(3-methylbutyl)deca-2,4,6-trienamide.
| Compound Name | N-(3-methylbutyl)deca-2,4,6-trienamide |
|---|---|
| PubChem CID | 163017819 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-(3-methylbutyl)deca-2,4,6-trienamide |
| SMILES | CCCC=CC=CC=CC(=O)NCCC(C)C |
| InChI | InChI=1S/C15H25NO/c1-4-5-6-7-8-9-10-11-15(17)16-13-12-14(2)3/h6-11,14H,4-5,12-13H2,1-3H3,(H,16,17) |
| InChIKey | SCPZCRFWGBTKEW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|