C32H52O2 — CID 163017877
(6,7,10,13,14,18,18-heptamethyl-19-hexacyclo[12.9.0.01,22.04,13.05,10.017,22]tricosanyl) acetate (PubChem CID 163017877) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is (6,7,10,13,14,18,18-heptamethyl-19-hexacyclo[12.9.0.01,22.04,13.05,10.017,22]tricosanyl) acetate.
| Compound Name | (6,7,10,13,14,18,18-heptamethyl-19-hexacyclo[12.9.0.01,22.04,13.05,10.017,22]tricosanyl) acetate |
|---|---|
| PubChem CID | 163017877 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (6,7,10,13,14,18,18-heptamethyl-19-hexacyclo[12.9.0.01,22.04,13.05,10.017,22]tricosanyl) acetate |
| SMILES | CC(=O)OC1CCC23CC24CCC2C5C(C)C(C)CCC5(C)CCC2(C)C4(C)CCC3C1(C)C |
| InChI | InChI=1S/C32H52O2/c1-20-9-13-28(6)17-18-29(7)23(26(28)21(20)2)10-16-32-19-31(32)15-12-25(34-22(3)33)27(4,5)24(31)11-14-30(29,32)8/h20-21,23-26H,9-19H2,1-8H3 |
| InChIKey | VOYFIPFXUCCCMN-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |