C33H52O5 — CID 85227875
(13-formyloxy-12-hydroxy-2,6,6,10,16,17,20-heptamethyl-7-hexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosanyl) acetate (PubChem CID 85227875) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is (13-formyloxy-12-hydroxy-2,6,6,10,16,17,20-heptamethyl-7-hexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosanyl) acetate.
| Compound Name | (13-formyloxy-12-hydroxy-2,6,6,10,16,17,20-heptamethyl-7-hexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosanyl) acetate |
|---|---|
| PubChem CID | 85227875 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (13-formyloxy-12-hydroxy-2,6,6,10,16,17,20-heptamethyl-7-hexacyclo[12.8.1.01,14.02,11.05,10.015,20]tricosanyl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2C(O)C(OC=O)C24CC32CCC2(C)CCC(C)C(C)C24)C1(C)C |
| InChI | InChI=1S/C33H52O5/c1-19-9-12-29(6)15-16-32-17-33(32,25(29)20(19)2)27(37-18-34)24(36)26-30(7)13-11-23(38-21(3)35)28(4,5)22(30)10-14-31(26,32)8/h18-20,22-27,36H,9-17H2,1-8H3 |
| InChIKey | ZCCHAKTYCBMAMA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|