C36H50O16 — CID 163019029
(1,8,10,12,14,15-hexaacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-9-yl) 2-methylpropanoate (PubChem CID 163019029) has the molecular formula C36H50O16 and a molecular weight of 738.78 g/mol. Its IUPAC name is (1,8,10,12,14,15-hexaacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-9-yl) 2-methylpropanoate.
| Compound Name | (1,8,10,12,14,15-hexaacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-9-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 163019029 |
| Molecular Formula | C36H50O16 |
| Molecular Weight | 738.78 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | (1,8,10,12,14,15-hexaacetyloxy-3,7,7,15-tetramethyl-11-methylidene-2-oxo-5-oxatricyclo[11.3.0.04,6]hexadecan-9-yl) 2-methylpropanoate |
| SMILES | C=C1C(OC(C)=O)C(OC(=O)C(C)C)C(OC(C)=O)C(C)(C)C2OC2C(C)C(=O)C2(OC(C)=O)CC(C)(OC(C)=O)C(OC(C)=O)C2C1OC(C)=O |
| InChI | InChI=1S/C36H50O16/c1-15(2)33(44)50-28-26(46-19(6)38)16(3)25(45-18(5)37)24-30(47-20(7)39)35(13,51-22(9)41)14-36(24,52-23(10)42)29(43)17(4)27-31(49-27)34(11,12)32(28)48-21(8)40/h15,17,24-28,30-32H,3,14H2,1-2,4-13H3 |
| InChIKey | MBQJEJCDRDNKGX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 213.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|