C18H21NO2 — CID 163021250
2-[(3Z,5Z,7S)-7-hydroxynona-3,5-dienyl]-1H-quinolin-4-one (PubChem CID 163021250) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[(3Z,5Z,7S)-7-hydroxynona-3,5-dienyl]-1H-quinolin-4-one.
| Compound Name | 2-[(3Z,5Z,7S)-7-hydroxynona-3,5-dienyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 163021250 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-[(3Z,5Z,7S)-7-hydroxynona-3,5-dienyl]-1H-quinolin-4-one |
| SMILES | CC[C@H](O)/C=C\C=C/CCc1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C18H21NO2/c1-2-15(20)10-6-4-3-5-9-14-13-18(21)16-11-7-8-12-17(16)19-14/h3-4,6-8,10-13,15,20H,2,5,9H2,1H3,(H,19,21)/b4-3-,10-6-/t15-/m0/s1 |
| InChIKey | UPZZBIGJSKRXQV-YVRXMCHWSA-N |
| XLogP | 3.34 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|