C33H56O — CID 163024207
(2S,3R)-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane (PubChem CID 163024207) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane.
| Compound Name | (2S,3R)-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane |
|---|---|
| PubChem CID | 163024207 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | (2S,3R)-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane |
| SMILES | C=C(C)[C@H](C)CCC(=C)[C@H](C)CC[C@]1(C)O[C@@H]1CC/C=C(\C)CC/C=C(\C)CC[C@H](C)C(=C)C |
| InChI | InChI=1S/C33H56O/c1-24(2)28(7)19-18-27(6)15-12-14-26(5)16-13-17-32-33(11,34-32)23-22-31(10)30(9)21-20-29(8)25(3)4/h15-16,28-29,31-32H,1,3,9,12-14,17-23H2,2,4-8,10-11H3/b26-16+,27-15+/t28-,29+,31+,32+,33-/m0/s1 |
| InChIKey | ISROTQRUKDWPSJ-SXIHHXIASA-N |
| XLogP | 10.55 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|