C22H32O5 — CID 163024286
methyl (1S,5R,6R,8R)-8-[(1S,2R,4aS)-1,2,5,5-tetramethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl]-3-oxo-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate (PubChem CID 163024286) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is methyl (1S,5R,6R,8R)-8-[(1S,2R,4aS)-1,2,5,5-tetramethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl]-3-oxo-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate.
| Compound Name | methyl (1S,5R,6R,8R)-8-[(1S,2R,4aS)-1,2,5,5-tetramethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl]-3-oxo-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate |
|---|---|
| PubChem CID | 163024286 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (1S,5R,6R,8R)-8-[(1S,2R,4aS)-1,2,5,5-tetramethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl]-3-oxo-2,7-dioxabicyclo[3.2.1]octane-6-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H]2OC(=O)C[C@@H]1[C@@H]2[C@]1(C)CC[C@@H]2C(=CCCC2(C)C)[C@H]1C |
| InChI | InChI=1S/C22H32O5/c1-12-13-7-6-9-21(2,3)15(13)8-10-22(12,4)17-14-11-16(23)26-20(17)27-18(14)19(24)25-5/h7,12,14-15,17-18,20H,6,8-11H2,1-5H3/t12-,14-,15-,17+,18-,20-,22-/m1/s1 |
| InChIKey | OXVHAVVVKDNRAO-RCYOPMTISA-N |
| XLogP | 3.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|