C21H30O5 — CID 163114707
[(2R,3R,3aR,6aR)-3-[(E)-4-(5,5-dimethylcyclohexen-1-yl)pent-2-en-3-yl]-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate (PubChem CID 163114707) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(2R,3R,3aR,6aR)-3-[(E)-4-(5,5-dimethylcyclohexen-1-yl)pent-2-en-3-yl]-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate.
| Compound Name | [(2R,3R,3aR,6aR)-3-[(E)-4-(5,5-dimethylcyclohexen-1-yl)pent-2-en-3-yl]-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
|---|---|
| PubChem CID | 163114707 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(2R,3R,3aR,6aR)-3-[(E)-4-(5,5-dimethylcyclohexen-1-yl)pent-2-en-3-yl]-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
| SMILES | C/C=C(\C(C)C1=CCCC(C)(C)C1)[C@@H]1[C@@H](OC(C)=O)O[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C21H30O5/c1-6-15(12(2)14-8-7-9-21(4,5)11-14)18-16-10-17(23)25-19(16)26-20(18)24-13(3)22/h6,8,12,16,18-20H,7,9-11H2,1-5H3/b15-6+/t12?,16-,18+,19+,20+/m1/s1 |
| InChIKey | WAKWQRLYHBSGJG-SLJCLKODSA-N |
| XLogP | 4.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|