C24H32O8 — CID 163107715
[(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate (PubChem CID 163107715) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate.
| Compound Name | [(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate |
|---|---|
| PubChem CID | 163107715 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@@H](OC(C)=O)O[C@H]2O[C@H]3OC(=O)/C(=C\C=C4\CCCC(C)(C)C4)[C@H]3[C@H]21 |
| InChI | InChI=1S/C24H32O8/c1-5-7-16(26)29-19-18-17-15(10-9-14-8-6-11-24(3,4)12-14)20(27)30-21(17)31-22(18)32-23(19)28-13(2)25/h9-10,17-19,21-23H,5-8,11-12H2,1-4H3/b14-9-,15-10-/t17-,18-,19-,21+,22+,23-/m0/s1 |
| InChIKey | BWSZCKKJVLOPJO-ZMQZXGJMSA-N |
| XLogP | 3.54 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|