C24H32O10 — CID 163190317
[(1R,2S,3S,4R,6S,8S,11Z)-4-acetyloxy-11-[2-[(1R)-1-acetyloxy-3,3-dimethylcyclohexyl]ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate (PubChem CID 163190317) has the molecular formula C24H32O10 and a molecular weight of 480.51 g/mol. Its IUPAC name is [(1R,2S,3S,4R,6S,8S,11Z)-4-acetyloxy-11-[2-[(1R)-1-acetyloxy-3,3-dimethylcyclohexyl]ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate.
| Compound Name | [(1R,2S,3S,4R,6S,8S,11Z)-4-acetyloxy-11-[2-[(1R)-1-acetyloxy-3,3-dimethylcyclohexyl]ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate |
|---|---|
| PubChem CID | 163190317 |
| Molecular Formula | C24H32O10 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [(1R,2S,3S,4R,6S,8S,11Z)-4-acetyloxy-11-[2-[(1R)-1-acetyloxy-3,3-dimethylcyclohexyl]ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H]2O[C@H]3OC(=O)/C(=C\C[C@]4(OC(C)=O)CCCC(C)(C)C4)[C@H]3[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H32O10/c1-12(25)29-18-17-16-15(7-10-24(34-14(3)27)9-6-8-23(4,5)11-24)19(28)31-20(16)32-21(17)33-22(18)30-13(2)26/h7,16-18,20-22H,6,8-11H2,1-5H3/b15-7-/t16-,17-,18-,20+,21-,22-,24+/m0/s1 |
| InChIKey | NMUUJHGEYJKFAT-YGRUZRHFSA-N |
| XLogP | 2.53 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|