C24H34O8 — CID 163114778
[4-acetyloxy-10-oxo-11-[(1,3,3-trimethylcyclohexyl)methylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate (PubChem CID 163114778) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [4-acetyloxy-10-oxo-11-[(1,3,3-trimethylcyclohexyl)methylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate.
| Compound Name | [4-acetyloxy-10-oxo-11-[(1,3,3-trimethylcyclohexyl)methylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate |
|---|---|
| PubChem CID | 163114778 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [4-acetyloxy-10-oxo-11-[(1,3,3-trimethylcyclohexyl)methylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] butanoate |
| SMILES | CCCC(=O)OC1C(OC(C)=O)OC2OC3OC(=O)C(=CC4(C)CCCC(C)(C)C4)C3C21 |
| InChI | InChI=1S/C24H34O8/c1-6-8-15(26)29-18-17-16-14(11-24(5)10-7-9-23(3,4)12-24)19(27)30-20(16)31-21(17)32-22(18)28-13(2)25/h11,16-18,20-22H,6-10,12H2,1-5H3 |
| InChIKey | WEMHJMZIQSEKDW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|