C7H12O4 — CID 174810344
[3-(hydroxymethyl)oxiran-2-yl] butanoate (PubChem CID 174810344) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is [3-(hydroxymethyl)oxiran-2-yl] butanoate.
| Compound Name | [3-(hydroxymethyl)oxiran-2-yl] butanoate |
|---|---|
| PubChem CID | 174810344 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | [3-(hydroxymethyl)oxiran-2-yl] butanoate |
| SMILES | CCCC(=O)OC1OC1CO |
| InChI | InChI=1S/C7H12O4/c1-2-3-6(9)11-7-5(4-8)10-7/h5,7-8H,2-4H2,1H3 |
| InChIKey | OIESUXBENYFXNY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|