C22H28O8 — CID 11004324
[(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate (PubChem CID 11004324) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate.
| Compound Name | [(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate |
|---|---|
| PubChem CID | 11004324 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(1R,2S,3S,4R,6R,8S,11Z)-4-acetyloxy-11-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-10-oxo-5,7,9-trioxatricyclo[6.3.0.02,6]undecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H]2O[C@H]3OC(=O)/C(=C\C=C4/CCCC(C)(C)C4)[C@H]3[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28O8/c1-11(23)26-17-16-15-14(8-7-13-6-5-9-22(3,4)10-13)18(25)28-19(15)29-20(16)30-21(17)27-12(2)24/h7-8,15-17,19-21H,5-6,9-10H2,1-4H3/b13-7+,14-8-/t15-,16-,17-,19+,20+,21-/m0/s1 |
| InChIKey | LJWUZALDGBNRAU-PHIRFXSHSA-N |
| XLogP | 2.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|