C18H22O4 — CID 10891987
(1R,2R,3E,6S,8S)-3-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undec-10-en-4-one (PubChem CID 10891987) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1R,2R,3E,6S,8S)-3-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undec-10-en-4-one.
| Compound Name | (1R,2R,3E,6S,8S)-3-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undec-10-en-4-one |
|---|---|
| PubChem CID | 10891987 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1R,2R,3E,6S,8S)-3-[(2E)-2-(3,3-dimethylcyclohexylidene)ethylidene]-5,7,9-trioxatricyclo[6.3.0.02,6]undec-10-en-4-one |
| SMILES | CC1(C)CCC/C(=C\C=C2\C(=O)O[C@@H]3O[C@@H]4OC=C[C@@H]4[C@H]23)C1 |
| InChI | InChI=1S/C18H22O4/c1-18(2)8-3-4-11(10-18)5-6-12-14-13-7-9-20-16(13)22-17(14)21-15(12)19/h5-7,9,13-14,16-17H,3-4,8,10H2,1-2H3/b11-5+,12-6+/t13-,14+,16+,17-/m1/s1 |
| InChIKey | VIGIFJITJWCMEC-DUWBHKDGSA-N |
| XLogP | 3.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|