C10H14O5 — CID 163024893
6-[(2S,3S)-2,3-dihydroxybutan-2-yl]-4-methoxypyran-2-one (PubChem CID 163024893) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-[(2S,3S)-2,3-dihydroxybutan-2-yl]-4-methoxypyran-2-one.
| Compound Name | 6-[(2S,3S)-2,3-dihydroxybutan-2-yl]-4-methoxypyran-2-one |
|---|---|
| PubChem CID | 163024893 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 6-[(2S,3S)-2,3-dihydroxybutan-2-yl]-4-methoxypyran-2-one |
| SMILES | COc1cc([C@@](C)(O)[C@H](C)O)oc(=O)c1 |
| InChI | InChI=1S/C10H14O5/c1-6(11)10(2,13)8-4-7(14-3)5-9(12)15-8/h4-6,11,13H,1-3H3/t6-,10-/m0/s1 |
| InChIKey | SGJAGMWFELNOAM-WKEGUHRASA-N |
| XLogP | 0.24 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |